About [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone
[4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone (PubChem CID 49070529) has the molecular formula C14H25F2N3O3S
and a molecular weight of 353.44 g/mol. Its IUPAC name is [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone.
Molecular Properties
| Compound Name | [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone |
| PubChem CID | 49070529 |
| Molecular Formula | C14H25F2N3O3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)N1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C14H25F2N3O3S/c1-2-10-23(21,22)19-5-3-4-12(19)14(20)18-8-6-17(7-9-18)11-13(15)16/h12-13H,2-11H2,1H3 |
| InChIKey | OBJZERFGVZYAPC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone?
The IUPAC name of [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone (CID 49070529) is [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone.
What is the SMILES notation for [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone?
The canonical SMILES for [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone is CCCS(=O)(=O)N1CCCC1C(=O)N1CCN(CC(F)F)CC1.
What is the InChIKey of [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone?
The InChIKey is OBJZERFGVZYAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2N3O3S/c1-2-10-23(21,22)19-5-3-4-12(19)14(20)18-8-6-17(7-9-18)11-13(15)16/h12-13H,2-11H2,1H3.
What are the key properties of [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone?
[4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone has a molecular weight of 353.44 g/mol, XLogP of 0.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-difluoroethyl)piperazin-1-yl]-(1-propylsulfonylpyrrolidin-2-yl)methanone is sourced from PubChem (CID 49070529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).