C22H20N4O5 — CID 4907473
N-(1,3-benzodioxol-5-yl)-6-(3-methoxypropyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 4907473) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(3-methoxypropyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(3-methoxypropyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 4907473 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(3-methoxypropyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | COCCCn1c(C(=O)Nc2ccc3c(c2)OCO3)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C22H20N4O5/c1-29-10-4-9-25-16(21(27)23-14-6-7-17-18(11-14)31-13-30-17)12-15-20(25)24-19-5-2-3-8-26(19)22(15)28/h2-3,5-8,11-12H,4,9-10,13H2,1H3,(H,23,27) |
| InChIKey | SKMZMEOPHHEOHX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|