C26H24N6O3S — CID 4907839
11,11-dimethyl-7-(4-methylanilino)-5-[(4-nitrophenyl)methylsulfanyl]-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 4907839) has the molecular formula C26H24N6O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is 11,11-dimethyl-7-(4-methylanilino)-5-[(4-nitrophenyl)methylsulfanyl]-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 11,11-dimethyl-7-(4-methylanilino)-5-[(4-nitrophenyl)methylsulfanyl]-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 4907839 |
| Molecular Formula | C26H24N6O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 11,11-dimethyl-7-(4-methylanilino)-5-[(4-nitrophenyl)methylsulfanyl]-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | Cc1ccc(Nc2c(C#N)c3c(c4nnc(SCc5ccc([N+](=O)[O-])cc5)n24)COC(C)(C)C3)cc1 |
| InChI | InChI=1S/C26H24N6O3S/c1-16-4-8-18(9-5-16)28-23-21(13-27)20-12-26(2,3)35-14-22(20)24-29-30-25(31(23)24)36-15-17-6-10-19(11-7-17)32(33)34/h4-11,28H,12,14-15H2,1-3H3 |
| InChIKey | QUDOQYAEBFDMSV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|