C12H13N3O3S — CID 4907993
6-amino-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 4907993) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 6-amino-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-amino-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 4907993 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 6-amino-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | Nc1cc(=O)[nH]c(=S)n1CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H13N3O3S/c13-10-6-11(18)14-12(19)15(10)4-3-7-1-2-8(16)9(17)5-7/h1-2,5-6,16-17H,3-4,13H2,(H,14,18,19) |
| InChIKey | WPCBFPRSDNRMRK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|