C28H27N5O3S — CID 4908018
ethyl 2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-2-phenylacetate (PubChem CID 4908018) has the molecular formula C28H27N5O3S and a molecular weight of 513.62 g/mol. Its IUPAC name is ethyl 2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-2-phenylacetate.
| Compound Name | ethyl 2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-2-phenylacetate |
|---|---|
| PubChem CID | 4908018 |
| Molecular Formula | C28H27N5O3S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | ethyl 2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-2-phenylacetate |
| SMILES | CCOC(=O)C(Sc1nnc2c3c(c(C#N)c(Nc4ccccc4)n12)CC(C)(C)OC3)c1ccccc1 |
| InChI | InChI=1S/C28H27N5O3S/c1-4-35-26(34)23(18-11-7-5-8-12-18)37-27-32-31-25-22-17-36-28(2,3)15-20(22)21(16-29)24(33(25)27)30-19-13-9-6-10-14-19/h5-14,23,30H,4,15,17H2,1-3H3 |
| InChIKey | UOOPVOAJJCDKLH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |