C15H17FN2O3S — CID 4908367
2-[(5-fluoro-1-methylindole-2-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 4908367) has the molecular formula C15H17FN2O3S and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(5-fluoro-1-methylindole-2-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(5-fluoro-1-methylindole-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 4908367 |
| Molecular Formula | C15H17FN2O3S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[(5-fluoro-1-methylindole-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)c1cc2cc(F)ccc2n1C)C(=O)O |
| InChI | InChI=1S/C15H17FN2O3S/c1-18-12-4-3-10(16)7-9(12)8-13(18)14(19)17-11(15(20)21)5-6-22-2/h3-4,7-8,11H,5-6H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | JECDKWTTWSSGRQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |