C20H19F3N2O3 — CID 49089739
N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-indol-1-ylpropanamide (PubChem CID 49089739) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-indol-1-ylpropanamide.
| Compound Name | N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-indol-1-ylpropanamide |
|---|---|
| PubChem CID | 49089739 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-indol-1-ylpropanamide |
| SMILES | O=C(CCn1ccc2ccccc21)NCC(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)28-16-7-5-15(6-8-16)18(26)13-24-19(27)10-12-25-11-9-14-3-1-2-4-17(14)25/h1-9,11,18,26H,10,12-13H2,(H,24,27) |
| InChIKey | UVQJSUMVBNNMEQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |