C17H16N4O3 — CID 4909192
4-[(4-methoxyphenoxy)methyl]-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4909192) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-[(4-methoxyphenoxy)methyl]-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[(4-methoxyphenoxy)methyl]-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4909192 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-[(4-methoxyphenoxy)methyl]-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | COc1ccc(OCc2nc3c4c(C)c(C)oc4ncn3n2)cc1 |
| InChI | InChI=1S/C17H16N4O3/c1-10-11(2)24-17-15(10)16-19-14(20-21(16)9-18-17)8-23-13-6-4-12(22-3)5-7-13/h4-7,9H,8H2,1-3H3 |
| InChIKey | ZKGFALIUDOEHDB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |