C13H16ClFN2O2 — CID 49094194
2-chloro-6-fluoro-N-[(4-methylmorpholin-2-yl)methyl]benzamide (PubChem CID 49094194) has the molecular formula C13H16ClFN2O2 and a molecular weight of 286.73 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[(4-methylmorpholin-2-yl)methyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[(4-methylmorpholin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 49094194 |
| Molecular Formula | C13H16ClFN2O2 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-chloro-6-fluoro-N-[(4-methylmorpholin-2-yl)methyl]benzamide |
| SMILES | CN1CCOC(CNC(=O)c2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C13H16ClFN2O2/c1-17-5-6-19-9(8-17)7-16-13(18)12-10(14)3-2-4-11(12)15/h2-4,9H,5-8H2,1H3,(H,16,18) |
| InChIKey | RYBNXHUMUXBBHZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |