C24H24ClN5O6 — CID 4909642
6'-chloro-7'-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4909642) has the molecular formula C24H24ClN5O6 and a molecular weight of 513.94 g/mol. Its IUPAC name is 6'-chloro-7'-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 6'-chloro-7'-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4909642 |
| Molecular Formula | C24H24ClN5O6 |
| Molecular Weight | 513.94 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 6'-chloro-7'-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2ccc3c(c2Cl)CC2(C(=O)N(C)C(=O)N(C)C2=O)C2CCCN32)C(=O)N(C)C1=O |
| InChI | InChI=1S/C24H24ClN5O6/c1-26-18(31)13(19(32)27(2)22(26)35)10-12-7-8-15-14(17(12)25)11-24(16-6-5-9-30(15)16)20(33)28(3)23(36)29(4)21(24)34/h7-8,10,16H,5-6,9,11H2,1-4H3 |
| InChIKey | JQFPZIQEUYBQHZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 118.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.94 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|