About 2-(diethylamino)ethyl 2,2-diphenylpentanoate
2-(diethylamino)ethyl 2,2-diphenylpentanoate (PubChem CID 4910) has the molecular formula C23H31NO2
and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2,2-diphenylpentanoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2,2-diphenylpentanoate |
| PubChem CID | 4910 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2-(diethylamino)ethyl 2,2-diphenylpentanoate |
| SMILES | CCCC(C(=O)OCCN(CC)CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-4-17-23(20-13-9-7-10-14-20,21-15-11-8-12-16-21)22(25)26-19-18-24(5-2)6-3/h7-16H,4-6,17-19H2,1-3H3 |
| InChIKey | SNTQPLDRUZOSDP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 2,2-diphenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2,2-diphenylpentanoate?
The IUPAC name of 2-(diethylamino)ethyl 2,2-diphenylpentanoate (CID 4910) is 2-(diethylamino)ethyl 2,2-diphenylpentanoate.
What is the SMILES notation for 2-(diethylamino)ethyl 2,2-diphenylpentanoate?
The canonical SMILES for 2-(diethylamino)ethyl 2,2-diphenylpentanoate is CCCC(C(=O)OCCN(CC)CC)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(diethylamino)ethyl 2,2-diphenylpentanoate?
The InChIKey is SNTQPLDRUZOSDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO2/c1-4-17-23(20-13-9-7-10-14-20,21-15-11-8-12-16-21)22(25)26-19-18-24(5-2)6-3/h7-16H,4-6,17-19H2,1-3H3.
What are the key properties of 2-(diethylamino)ethyl 2,2-diphenylpentanoate?
2-(diethylamino)ethyl 2,2-diphenylpentanoate has a molecular weight of 353.51 g/mol, XLogP of 4.66, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2,2-diphenylpentanoate is sourced from PubChem (CID 4910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).