C27H27N5OS — CID 4910579
7-anilino-11,11-dimethyl-5-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 4910579) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is 7-anilino-11,11-dimethyl-5-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 7-anilino-11,11-dimethyl-5-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 4910579 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 7-anilino-11,11-dimethyl-5-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CC1(C)Cc2c(C#N)c(Nc3ccccc3)n3c(SCCCc4ccccc4)nnc3c2CO1 |
| InChI | InChI=1S/C27H27N5OS/c1-27(2)16-21-22(17-28)24(29-20-13-7-4-8-14-20)32-25(23(21)18-33-27)30-31-26(32)34-15-9-12-19-10-5-3-6-11-19/h3-8,10-11,13-14,29H,9,12,15-16,18H2,1-2H3 |
| InChIKey | CQKPUURGZXOTGW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|