C22H23N7O6 — CID 4910711
8'-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4910711) has the molecular formula C22H23N7O6 and a molecular weight of 481.47 g/mol. Its IUPAC name is 8'-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 8'-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4910711 |
| Molecular Formula | C22H23N7O6 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 8'-[(6-hydroxy-1-methyl-2,4-dioxopyrimidin-5-yl)methylideneamino]-3'-methylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CN1CCN2c3ccc(/N=C/c4c(O)n(C)c(=O)[nH]c4=O)cc3CC3(C(=O)NC(=O)NC3=O)C2C1 |
| InChI | InChI=1S/C22H23N7O6/c1-27-5-6-29-14-4-3-12(23-9-13-16(30)24-21(35)28(2)17(13)31)7-11(14)8-22(15(29)10-27)18(32)25-20(34)26-19(22)33/h3-4,7,9,15,31H,5-6,8,10H2,1-2H3,(H,24,30,35)(H2,25,26,32,33,34)/b23-9+ |
| InChIKey | YCUIURKQRGJPBZ-NUGSKGIGSA-N |
| XLogP | -1.44 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|