C31H27N3O6S — CID 4910910
13-[4-(azepan-1-ylsulfonyl)phenyl]-14-(5-methyl-1,2-oxazol-3-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 4910910) has the molecular formula C31H27N3O6S and a molecular weight of 569.64 g/mol. Its IUPAC name is 13-[4-(azepan-1-ylsulfonyl)phenyl]-14-(5-methyl-1,2-oxazol-3-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | 13-[4-(azepan-1-ylsulfonyl)phenyl]-14-(5-methyl-1,2-oxazol-3-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 4910910 |
| Molecular Formula | C31H27N3O6S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 13-[4-(azepan-1-ylsulfonyl)phenyl]-14-(5-methyl-1,2-oxazol-3-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | Cc1cc(N2C(=O)c3oc4c(ccc5ccccc54)c(=O)c3C2c2ccc(S(=O)(=O)N3CCCCCC3)cc2)no1 |
| InChI | InChI=1S/C31H27N3O6S/c1-19-18-25(32-40-19)34-27(21-10-13-22(14-11-21)41(37,38)33-16-6-2-3-7-17-33)26-28(35)24-15-12-20-8-4-5-9-23(20)29(24)39-30(26)31(34)36/h4-5,8-15,18,27H,2-3,6-7,16-17H2,1H3 |
| InChIKey | OHRRZMIBPOTLBY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 113.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|