About N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide
N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide (PubChem CID 49110742) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide.
Molecular Properties
| Compound Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide |
| PubChem CID | 49110742 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide |
| SMILES | Cc1cc(CNC(=O)N2CCc3ccccc32)on1 |
| InChI | InChI=1S/C14H15N3O2/c1-10-8-12(19-16-10)9-15-14(18)17-7-6-11-4-2-3-5-13(11)17/h2-5,8H,6-7,9H2,1H3,(H,15,18) |
| InChIKey | CVNGGFBWONFIHR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide?
The IUPAC name of N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide (CID 49110742) is N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide.
What is the SMILES notation for N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide?
The canonical SMILES for N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide is Cc1cc(CNC(=O)N2CCc3ccccc32)on1.
What is the InChIKey of N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide?
The InChIKey is CVNGGFBWONFIHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-10-8-12(19-16-10)9-15-14(18)17-7-6-11-4-2-3-5-13(11)17/h2-5,8H,6-7,9H2,1H3,(H,15,18).
What are the key properties of N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide?
N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide has a molecular weight of 257.29 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,3-dihydroindole-1-carboxamide is sourced from PubChem (CID 49110742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).