C28H22N2O4 — CID 4911380
14-(5-methyl-1,2-oxazol-3-yl)-15-(4-propan-2-ylphenyl)-11-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-13,17-dione (PubChem CID 4911380) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is 14-(5-methyl-1,2-oxazol-3-yl)-15-(4-propan-2-ylphenyl)-11-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-13,17-dione.
| Compound Name | 14-(5-methyl-1,2-oxazol-3-yl)-15-(4-propan-2-ylphenyl)-11-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-13,17-dione |
|---|---|
| PubChem CID | 4911380 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 14-(5-methyl-1,2-oxazol-3-yl)-15-(4-propan-2-ylphenyl)-11-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-13,17-dione |
| SMILES | Cc1cc(N2C(=O)c3oc4ccc5ccccc5c4c(=O)c3C2c2ccc(C(C)C)cc2)no1 |
| InChI | InChI=1S/C28H22N2O4/c1-15(2)17-8-10-19(11-9-17)25-24-26(31)23-20-7-5-4-6-18(20)12-13-21(23)33-27(24)28(32)30(25)22-14-16(3)34-29-22/h4-15,25H,1-3H3 |
| InChIKey | PAPKZGKSYRQKHU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 76.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|