C20H26N4O3S — CID 4911401
6-cyclohexyl-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 4911401) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 6-cyclohexyl-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 6-cyclohexyl-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4911401 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 6-cyclohexyl-1-[2-(3,4-dihydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(CCc2ccc(O)c(O)c2)c2c1CN(C1CCCCC1)CN2 |
| InChI | InChI=1S/C20H26N4O3S/c25-16-7-6-13(10-17(16)26)8-9-24-18-15(19(27)22-20(24)28)11-23(12-21-18)14-4-2-1-3-5-14/h6-7,10,14,21,25-26H,1-5,8-9,11-12H2,(H,22,27,28) |
| InChIKey | AWSMKDVYCIISMT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|