C15H24N4O2S — CID 4912001
7-(morpholin-4-ylamino)-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 4912001) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 7-(morpholin-4-ylamino)-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-(morpholin-4-ylamino)-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 4912001 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 7-(morpholin-4-ylamino)-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCCc1c(NN2CCOCC2)nc2n(c1=O)CCS2 |
| InChI | InChI=1S/C15H24N4O2S/c1-2-3-4-5-12-13(17-18-6-9-21-10-7-18)16-15-19(14(12)20)8-11-22-15/h17H,2-11H2,1H3 |
| InChIKey | ONGLTQVEOGQMGD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|