C16H18N4O7 — CID 4912075
1'-(2,2-dimethoxyethyl)-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 4912075) has the molecular formula C16H18N4O7 and a molecular weight of 378.34 g/mol. Its IUPAC name is 1'-(2,2-dimethoxyethyl)-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | 1'-(2,2-dimethoxyethyl)-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4912075 |
| Molecular Formula | C16H18N4O7 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1'-(2,2-dimethoxyethyl)-6'-nitrospiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | COC(CN1CC2(Cc3cc([N+](=O)[O-])ccc31)C(=O)NC(=O)NC2=O)OC |
| InChI | InChI=1S/C16H18N4O7/c1-26-12(27-2)7-19-8-16(13(21)17-15(23)18-14(16)22)6-9-5-10(20(24)25)3-4-11(9)19/h3-5,12H,6-8H2,1-2H3,(H2,17,18,21,22,23) |
| InChIKey | LYYJYTOKEOEJDM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|