C19H22ClN3O3 — CID 4912529
1-tert-butyl-6'-chlorospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4912529) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 1-tert-butyl-6'-chlorospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 1-tert-butyl-6'-chlorospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4912529 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-tert-butyl-6'-chlorospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CC(C)(C)N1C(=O)NC(=O)C2(Cc3c(Cl)cccc3N3CCCC32)C1=O |
| InChI | InChI=1S/C19H22ClN3O3/c1-18(2,3)23-16(25)19(15(24)21-17(23)26)10-11-12(20)6-4-7-13(11)22-9-5-8-14(19)22/h4,6-7,14H,5,8-10H2,1-3H3,(H,21,24,26) |
| InChIKey | WDFXRWOELWJQGT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|