C13H12N6O — CID 4912610
N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)acetohydrazide (PubChem CID 4912610) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)acetohydrazide.
| Compound Name | N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 4912610 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N'-(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)acetohydrazide |
| SMILES | CC(=O)NNc1ncnc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C13H12N6O/c1-9(20)17-18-12-11-7-16-19(13(11)15-8-14-12)10-5-3-2-4-6-10/h2-8H,1H3,(H,17,20)(H,14,15,18) |
| InChIKey | KBKIKSJHYIDZSJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|