About 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid
1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid (PubChem CID 4912935) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid |
| PubChem CID | 4912935 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(-c2ccno2)c1C(=O)O |
| InChI | InChI=1S/C8H7N3O3/c1-11-7(8(12)13)5(4-9-11)6-2-3-10-14-6/h2-4H,1H3,(H,12,13) |
| InChIKey | IPKLNHHOWOKQKK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid?
The IUPAC name of 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid (CID 4912935) is 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid.
What is the SMILES notation for 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid?
The canonical SMILES for 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid is Cn1ncc(-c2ccno2)c1C(=O)O.
What is the InChIKey of 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid?
The InChIKey is IPKLNHHOWOKQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c1-11-7(8(12)13)5(4-9-11)6-2-3-10-14-6/h2-4H,1H3,(H,12,13).
What are the key properties of 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid?
1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid has a molecular weight of 193.16 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid is sourced from PubChem (CID 4912935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).