C22H31NO8 — CID 4912949
methyl 2-[(7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoate (PubChem CID 4912949) has the molecular formula C22H31NO8 and a molecular weight of 437.49 g/mol. Its IUPAC name is methyl 2-[(7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoate.
| Compound Name | methyl 2-[(7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoate |
|---|---|
| PubChem CID | 4912949 |
| Molecular Formula | C22H31NO8 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | methyl 2-[(7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoate |
| SMILES | COC(=O)C(C)OC1C(NC(C)=O)C(OCc2ccccc2)OC2COC(C)(C)OC21 |
| InChI | InChI=1S/C22H31NO8/c1-13(20(25)26-5)29-19-17(23-14(2)24)21(27-11-15-9-7-6-8-10-15)30-16-12-28-22(3,4)31-18(16)19/h6-10,13,16-19,21H,11-12H2,1-5H3,(H,23,24) |
| InChIKey | OEKDBUGAXUPTRV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |