C9H9NO6 — CID 4913003
2,4-dimethoxy-6-nitrobenzoic acid (PubChem CID 4913003) has the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. Its IUPAC name is 2,4-dimethoxy-6-nitrobenzoic acid.
| Compound Name | 2,4-dimethoxy-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 4913003 |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2,4-dimethoxy-6-nitrobenzoic acid |
| SMILES | COc1cc(OC)c(C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9NO6/c1-15-5-3-6(10(13)14)8(9(11)12)7(4-5)16-2/h3-4H,1-2H3,(H,11,12) |
| InChIKey | NWJKDKBOADFMPZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|