About 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea
1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea (PubChem CID 49134562) has the molecular formula C17H26F3N3O
and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
| PubChem CID | 49134562 |
| Molecular Formula | C17H26F3N3O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea |
| SMILES | O=C(NC1CCN(CC(F)(F)F)C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H26F3N3O/c18-17(19,20)10-23-2-1-14(9-23)21-15(24)22-16-6-11-3-12(7-16)5-13(4-11)8-16/h11-14H,1-10H2,(H2,21,22,24) |
| InChIKey | RJFRVXAPALOJGP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea?
The IUPAC name of 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea (CID 49134562) is 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea.
What is the SMILES notation for 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea?
The canonical SMILES for 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea is O=C(NC1CCN(CC(F)(F)F)C1)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea?
The InChIKey is RJFRVXAPALOJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26F3N3O/c18-17(19,20)10-23-2-1-14(9-23)21-15(24)22-16-6-11-3-12(7-16)5-13(4-11)8-16/h11-14H,1-10H2,(H2,21,22,24).
What are the key properties of 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea?
1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea has a molecular weight of 345.41 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]urea is sourced from PubChem (CID 49134562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).