C20H18N4O6S — CID 4913545
2-(3,4-dimethoxyphenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 4913545) has the molecular formula C20H18N4O6S and a molecular weight of 442.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 4913545 |
| Molecular Formula | C20H18N4O6S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | COc1ccc(C2=NN3C(C2)c2cc([N+](=O)[O-])ccc2OC32CSC(=O)N2)cc1OC |
| InChI | InChI=1S/C20H18N4O6S/c1-28-17-5-3-11(7-18(17)29-2)14-9-15-13-8-12(24(26)27)4-6-16(13)30-20(23(15)22-14)10-31-19(25)21-20/h3-8,15H,9-10H2,1-2H3,(H,21,25) |
| InChIKey | WFDBUFCDVRPJEF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|