About N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide
N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide (PubChem CID 4913572) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide |
| PubChem CID | 4913572 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide |
| SMILES | O=C(CC1COC(=O)C(=O)N1Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c23-18(21-12-15-7-3-1-4-8-15)11-17-14-26-20(25)19(24)22(17)13-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,23) |
| InChIKey | HOYPDCLOIQOHAX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide?
The IUPAC name of N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide (CID 4913572) is N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide.
What is the SMILES notation for N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide?
The canonical SMILES for N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide is O=C(CC1COC(=O)C(=O)N1Cc1ccccc1)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide?
The InChIKey is HOYPDCLOIQOHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4/c23-18(21-12-15-7-3-1-4-8-15)11-17-14-26-20(25)19(24)22(17)13-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,23).
What are the key properties of N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide?
N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide has a molecular weight of 352.39 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(4-benzyl-5,6-dioxomorpholin-3-yl)acetamide is sourced from PubChem (CID 4913572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).