C24H21NO5 — CID 4913878
3-(furan-2-ylmethyl)-6-(4-methoxyphenyl)-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one (PubChem CID 4913878) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-6-(4-methoxyphenyl)-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one.
| Compound Name | 3-(furan-2-ylmethyl)-6-(4-methoxyphenyl)-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
|---|---|
| PubChem CID | 4913878 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-(furan-2-ylmethyl)-6-(4-methoxyphenyl)-10-methyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
| SMILES | COc1ccc(-c2cc(=O)oc3c(C)c4c(cc23)CN(Cc2ccco2)CO4)cc1 |
| InChI | InChI=1S/C24H21NO5/c1-15-23-17(12-25(14-29-23)13-19-4-3-9-28-19)10-21-20(11-22(26)30-24(15)21)16-5-7-18(27-2)8-6-16/h3-11H,12-14H2,1-2H3 |
| InChIKey | LOFHDAHZVXTMHB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|