C20H26N2O9 — CID 4914417
[5-acetamido-3,4-diacetyloxy-6-(2-aminophenoxy)oxan-2-yl]methyl acetate (PubChem CID 4914417) has the molecular formula C20H26N2O9 and a molecular weight of 438.43 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-(2-aminophenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-(2-aminophenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 4914417 |
| Molecular Formula | C20H26N2O9 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-(2-aminophenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(Oc2ccccc2N)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H26N2O9/c1-10(23)22-17-19(29-13(4)26)18(28-12(3)25)16(9-27-11(2)24)31-20(17)30-15-8-6-5-7-14(15)21/h5-8,16-20H,9,21H2,1-4H3,(H,22,23) |
| InChIKey | WZZGCOPXOMGKET-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|