C18H15F3N2O — CID 4914428
7,8,10-trifluoro-9-piperidin-1-ylbenzo[b][1,4]benzoxazepine (PubChem CID 4914428) has the molecular formula C18H15F3N2O and a molecular weight of 332.32 g/mol. Its IUPAC name is 7,8,10-trifluoro-9-piperidin-1-ylbenzo[b][1,4]benzoxazepine.
| Compound Name | 7,8,10-trifluoro-9-piperidin-1-ylbenzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 4914428 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 7,8,10-trifluoro-9-piperidin-1-ylbenzo[b][1,4]benzoxazepine |
| SMILES | Fc1c(F)c(N2CCCCC2)c(F)c2c1C=Nc1ccccc1O2 |
| InChI | InChI=1S/C18H15F3N2O/c19-14-11-10-22-12-6-2-3-7-13(12)24-18(11)16(21)17(15(14)20)23-8-4-1-5-9-23/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIKey | XNPFKXMILAQRFR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|