C15H12ClNO3 — CID 4914818
2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetonitrile (PubChem CID 4914818) has the molecular formula C15H12ClNO3 and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetonitrile.
| Compound Name | 2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetonitrile |
|---|---|
| PubChem CID | 4914818 |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]acetonitrile |
| SMILES | N#CCOc1cc2oc(=O)c3c(c2cc1Cl)CCCC3 |
| InChI | InChI=1S/C15H12ClNO3/c16-12-7-11-9-3-1-2-4-10(9)15(18)20-13(11)8-14(12)19-6-5-17/h7-8H,1-4,6H2 |
| InChIKey | QQQJMNZEBQDGKB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|