C23H16ClF3N2O2 — CID 4915364
methyl 4-[1-[(4-chlorophenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]benzoate (PubChem CID 4915364) has the molecular formula C23H16ClF3N2O2 and a molecular weight of 444.84 g/mol. Its IUPAC name is methyl 4-[1-[(4-chlorophenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]benzoate.
| Compound Name | methyl 4-[1-[(4-chlorophenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]benzoate |
|---|---|
| PubChem CID | 4915364 |
| Molecular Formula | C23H16ClF3N2O2 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | methyl 4-[1-[(4-chlorophenyl)methyl]-5-(trifluoromethyl)benzimidazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc3cc(C(F)(F)F)ccc3n2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H16ClF3N2O2/c1-31-22(30)16-6-4-15(5-7-16)21-28-19-12-17(23(25,26)27)8-11-20(19)29(21)13-14-2-9-18(24)10-3-14/h2-12H,13H2,1H3 |
| InChIKey | RROCNRKCHZOINW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |