C19H18ClFN4OS — CID 49155387
1-(2-chloro-4,6-dimethylphenyl)-3-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea (PubChem CID 49155387) has the molecular formula C19H18ClFN4OS and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea |
|---|---|
| PubChem CID | 49155387 |
| Molecular Formula | C19H18ClFN4OS |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea |
| SMILES | Cc1cc(C)c(NC(=S)NC(C)c2nc(-c3ccc(F)cc3)no2)c(Cl)c1 |
| InChI | InChI=1S/C19H18ClFN4OS/c1-10-8-11(2)16(15(20)9-10)23-19(27)22-12(3)18-24-17(25-26-18)13-4-6-14(21)7-5-13/h4-9,12H,1-3H3,(H2,22,23,27) |
| InChIKey | PPKXUDFVTBHHCU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|