C27H28N4O2 — CID 4915547
ethyl 1-benzyl-2-[4-(N'-propan-2-ylcarbamimidoyl)phenyl]benzimidazole-5-carboxylate (PubChem CID 4915547) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is ethyl 1-benzyl-2-[4-(N'-propan-2-ylcarbamimidoyl)phenyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-benzyl-2-[4-(N'-propan-2-ylcarbamimidoyl)phenyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 4915547 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | ethyl 1-benzyl-2-[4-(N'-propan-2-ylcarbamimidoyl)phenyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(-c1ccc(/C(N)=N/C(C)C)cc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C27H28N4O2/c1-4-33-27(32)22-14-15-24-23(16-22)30-26(31(24)17-19-8-6-5-7-9-19)21-12-10-20(11-13-21)25(28)29-18(2)3/h5-16,18H,4,17H2,1-3H3,(H2,28,29) |
| InChIKey | TXFKNBRFOSJDLI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|