C22H22BrF3N4O3 — CID 4915777
2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-bromo-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 4915777) has the molecular formula C22H22BrF3N4O3 and a molecular weight of 527.34 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-bromo-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-bromo-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 4915777 |
| Molecular Formula | C22H22BrF3N4O3 |
| Molecular Weight | 527.34 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-bromo-5-(furan-2-yl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | O=C(OCC1CCCN2CCCCC12)c1nn2c(C(F)(F)F)cc(-c3ccco3)nc2c1Br |
| InChI | InChI=1S/C22H22BrF3N4O3/c23-18-19(21(31)33-12-13-5-3-9-29-8-2-1-6-15(13)29)28-30-17(22(24,25)26)11-14(27-20(18)30)16-7-4-10-32-16/h4,7,10-11,13,15H,1-3,5-6,8-9,12H2 |
| InChIKey | BMDPDQKQDWHOTJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |