C12H14N2O4S — CID 4916037
6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 4916037) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 4916037 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(S(=O)(=O)N3CCCC3)cc2N1 |
| InChI | InChI=1S/C12H14N2O4S/c15-12-8-18-11-4-3-9(7-10(11)13-12)19(16,17)14-5-1-2-6-14/h3-4,7H,1-2,5-6,8H2,(H,13,15) |
| InChIKey | SPTCQXYPKJALBK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |