C11H7N3OS — CID 4916164
5-pyridin-3-yl-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 4916164) has the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. Its IUPAC name is 5-pyridin-3-yl-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-pyridin-3-yl-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 4916164 |
| Molecular Formula | C11H7N3OS |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 5-pyridin-3-yl-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | c1cncc(-c2nc(-c3cccs3)no2)c1 |
| InChI | InChI=1S/C11H7N3OS/c1-3-8(7-12-5-1)11-13-10(14-15-11)9-4-2-6-16-9/h1-7H |
| InChIKey | YWJZRAHEPABBHR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |