About 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile
3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile (PubChem CID 4916546) has the molecular formula C10H14N6O3
and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile |
| PubChem CID | 4916546 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile |
| SMILES | N#CCCN1CCN(C(=O)c2c(N)no[n+]2[O-])CC1 |
| InChI | InChI=1S/C10H14N6O3/c11-2-1-3-14-4-6-15(7-5-14)10(17)8-9(12)13-19-16(8)18/h1,3-7H2,(H2,12,13) |
| InChIKey | BCXMGIBSWTWNPP-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile?
The IUPAC name of 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile (CID 4916546) is 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile.
What is the SMILES notation for 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile?
The canonical SMILES for 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile is N#CCCN1CCN(C(=O)c2c(N)no[n+]2[O-])CC1.
What is the InChIKey of 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile?
The InChIKey is BCXMGIBSWTWNPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O3/c11-2-1-3-14-4-6-15(7-5-14)10(17)8-9(12)13-19-16(8)18/h1,3-7H2,(H2,12,13).
What are the key properties of 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile?
3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile has a molecular weight of 266.26 g/mol, XLogP of -1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-amino-2-oxido-1,2,5-oxadiazol-2-ium-3-carbonyl)piperazin-1-yl]propanenitrile is sourced from PubChem (CID 4916546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).