C27H30ClN3O3S — CID 4916557
5-butyl-1'-[(2-chlorophenyl)methyl]-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 4916557) has the molecular formula C27H30ClN3O3S and a molecular weight of 512.08 g/mol. Its IUPAC name is 5-butyl-1'-[(2-chlorophenyl)methyl]-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | 5-butyl-1'-[(2-chlorophenyl)methyl]-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4916557 |
| Molecular Formula | C27H30ClN3O3S |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 5-butyl-1'-[(2-chlorophenyl)methyl]-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | CCCCN1C(=O)C2C(CCSC)NC3(C(=O)N(Cc4ccccc4Cl)c4ccccc43)C2C1=O |
| InChI | InChI=1S/C27H30ClN3O3S/c1-3-4-14-30-24(32)22-20(13-15-35-2)29-27(23(22)25(30)33)18-10-6-8-12-21(18)31(26(27)34)16-17-9-5-7-11-19(17)28/h5-12,20,22-23,29H,3-4,13-16H2,1-2H3 |
| InChIKey | IAIXAIAYQAHPPU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|