C26H27N3O5S — CID 4916569
ethyl 2-[1-(2-methylsulfanylethyl)-2',4,6-trioxo-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1'-yl]acetate (PubChem CID 4916569) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is ethyl 2-[1-(2-methylsulfanylethyl)-2',4,6-trioxo-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1'-yl]acetate.
| Compound Name | ethyl 2-[1-(2-methylsulfanylethyl)-2',4,6-trioxo-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1'-yl]acetate |
|---|---|
| PubChem CID | 4916569 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | ethyl 2-[1-(2-methylsulfanylethyl)-2',4,6-trioxo-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1'-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2(NC(CCSC)C3C(=O)N(c4ccccc4)C(=O)C32)c2ccccc21 |
| InChI | InChI=1S/C26H27N3O5S/c1-3-34-20(30)15-28-19-12-8-7-11-17(19)26(25(28)33)22-21(18(27-26)13-14-35-2)23(31)29(24(22)32)16-9-5-4-6-10-16/h4-12,18,21-22,27H,3,13-15H2,1-2H3 |
| InChIKey | WLSNEQRAVQHCFH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|