C14H24N2O5 — CID 49166
5-[2-(2-Butoxyethoxy)ethyl]-5-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 49166) has the molecular formula C14H24N2O5 and a molecular weight of 300.35 g/mol. Its IUPAC name is 5-[2-(2-butoxyethoxy)ethyl]-5-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-(2-Butoxyethoxy)ethyl]-5-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 49166 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 5-[2-(2-butoxyethoxy)ethyl]-5-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCOCCOCCC1(C(=O)NC(=O)NC1=O)CC |
| InChIKey | GXLSTOKJKGUIJT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | 364 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|