About 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine
4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 4916649) has the molecular formula C14H15BrN2O2S2
and a molecular weight of 387.32 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine |
| PubChem CID | 4916649 |
| Molecular Formula | C14H15BrN2O2S2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CN(c1nc(-c2ccc(Br)cc2)cs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15BrN2O2S2/c1-17(12-6-7-21(18,19)9-12)14-16-13(8-20-14)10-2-4-11(15)5-3-10/h2-5,8,12H,6-7,9H2,1H3 |
| InChIKey | IHAPMOBRYZOQFE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine?
The IUPAC name of 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine (CID 4916649) is 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine is CN(c1nc(-c2ccc(Br)cc2)cs1)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine?
The InChIKey is IHAPMOBRYZOQFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2O2S2/c1-17(12-6-7-21(18,19)9-12)14-16-13(8-20-14)10-2-4-11(15)5-3-10/h2-5,8,12H,6-7,9H2,1H3.
What are the key properties of 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine?
4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine has a molecular weight of 387.32 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 4916649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).