C31H36N2O5S — CID 4917083
ethyl 2-[[4-(3-methoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4917083) has the molecular formula C31H36N2O5S and a molecular weight of 548.71 g/mol. Its IUPAC name is ethyl 2-[[4-(3-methoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-(3-methoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4917083 |
| Molecular Formula | C31H36N2O5S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | ethyl 2-[[4-(3-methoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2=C(C)NC3=C(C(=O)CC(C)(C)C3)C2c2cccc(OC)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C31H36N2O5S/c1-6-38-30(36)26-20-12-7-8-13-23(20)39-29(26)33-28(35)24-17(2)32-21-15-31(3,4)16-22(34)27(21)25(24)18-10-9-11-19(14-18)37-5/h9-11,14,25,32H,6-8,12-13,15-16H2,1-5H3,(H,33,35) |
| InChIKey | BWTJYUCELJZXFS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |