About 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile
5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile (PubChem CID 4917361) has the molecular formula C20H17N5
and a molecular weight of 327.39 g/mol. Its IUPAC name is 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile.
Molecular Properties
| Compound Name | 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile |
| PubChem CID | 4917361 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile |
| SMILES | N#CC1=C(N)N(c2ccccc2)C(C2CC3C=CC2C3)C1(C#N)C#N |
| InChI | InChI=1S/C20H17N5/c21-10-17-19(24)25(15-4-2-1-3-5-15)18(20(17,11-22)12-23)16-9-13-6-7-14(16)8-13/h1-7,13-14,16,18H,8-9,24H2 |
| InChIKey | LAAMVVDACMVNFP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
The IUPAC name of 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile (CID 4917361) is 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile.
What is the SMILES notation for 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
The canonical SMILES for 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile is N#CC1=C(N)N(c2ccccc2)C(C2CC3C=CC2C3)C1(C#N)C#N.
What is the InChIKey of 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
The InChIKey is LAAMVVDACMVNFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5/c21-10-17-19(24)25(15-4-2-1-3-5-15)18(20(17,11-22)12-23)16-9-13-6-7-14(16)8-13/h1-7,13-14,16,18H,8-9,24H2.
What are the key properties of 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile has a molecular weight of 327.39 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2-bicyclo[2.2.1]hept-5-enyl)-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile is sourced from PubChem (CID 4917361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).