C19H19N3OS — CID 4917811
1'-butyl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (PubChem CID 4917811) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 1'-butyl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one.
| Compound Name | 1'-butyl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 4917811 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1'-butyl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| SMILES | CCCCN1C(=O)C2(NN=C(c3ccccc3)S2)c2ccccc21 |
| InChI | InChI=1S/C19H19N3OS/c1-2-3-13-22-16-12-8-7-11-15(16)19(18(22)23)21-20-17(24-19)14-9-5-4-6-10-14/h4-12,21H,2-3,13H2,1H3 |
| InChIKey | UZWNINAIFFTNSD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|