About 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine
4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 4918092) has the molecular formula C22H23N4O+
and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine |
| PubChem CID | 4918092 |
| Molecular Formula | C22H23N4O+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Cc1cccc([NH+]2CCN(c3ncnc4c3oc3ccccc34)CC2)c1C |
| InChI | InChI=1S/C22H22N4O/c1-15-6-5-8-18(16(15)2)25-10-12-26(13-11-25)22-21-20(23-14-24-22)17-7-3-4-9-19(17)27-21/h3-9,14H,10-13H2,1-2H3/p+1 |
| InChIKey | DHKCQIXAKSEODA-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 46.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine?
The IUPAC name of 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine (CID 4918092) is 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine.
What is the SMILES notation for 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine?
The canonical SMILES for 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine is Cc1cccc([NH+]2CCN(c3ncnc4c3oc3ccccc34)CC2)c1C.
What is the InChIKey of 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine?
The InChIKey is DHKCQIXAKSEODA-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H22N4O/c1-15-6-5-8-18(16(15)2)25-10-12-26(13-11-25)22-21-20(23-14-24-22)17-7-3-4-9-19(17)27-21/h3-9,14H,10-13H2,1-2H3/p+1.
What are the key properties of 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine?
4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine has a molecular weight of 359.45 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,3-dimethylphenyl)piperazin-4-ium-1-yl]-[1]benzofuro[3,2-d]pyrimidine is sourced from PubChem (CID 4918092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).