About 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol
4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol (PubChem CID 4918356) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol |
| PubChem CID | 4918356 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol |
| SMILES | C=CC#CC1(O)CC(C)N(C)CC1C |
| InChI | InChI=1S/C12H19NO/c1-5-6-7-12(14)8-11(3)13(4)9-10(12)2/h5,10-11,14H,1,8-9H2,2-4H3 |
| InChIKey | HERPIZXRZSGXDN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol?
The IUPAC name of 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol (CID 4918356) is 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol.
What is the SMILES notation for 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol?
The canonical SMILES for 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol is C=CC#CC1(O)CC(C)N(C)CC1C.
What is the InChIKey of 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol?
The InChIKey is HERPIZXRZSGXDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-5-6-7-12(14)8-11(3)13(4)9-10(12)2/h5,10-11,14H,1,8-9H2,2-4H3.
What are the key properties of 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol?
4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol has a molecular weight of 193.29 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-en-1-ynyl-1,2,5-trimethylpiperidin-4-ol is sourced from PubChem (CID 4918356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).