C26H22F3N3O4 — CID 4918753
N-(3,4-difluorophenyl)-2-[1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 4918753) has the molecular formula C26H22F3N3O4 and a molecular weight of 497.47 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 4918753 |
| Molecular Formula | C26H22F3N3O4 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[1-(4-fluorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | COc1ccc(CCN2C(=O)N(c3ccc(F)cc3)C(=O)C2CC(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C26H22F3N3O4/c1-36-20-9-2-16(3-10-20)12-13-31-23(15-24(33)30-18-6-11-21(28)22(29)14-18)25(34)32(26(31)35)19-7-4-17(27)5-8-19/h2-11,14,23H,12-13,15H2,1H3,(H,30,33) |
| InChIKey | LUXACMJSGFMCRS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|