C33H42O6 — CID 4918984
5,6,12,13,19,20-hexaethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene (PubChem CID 4918984) has the molecular formula C33H42O6 and a molecular weight of 534.69 g/mol. Its IUPAC name is 5,6,12,13,19,20-hexaethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene.
| Compound Name | 5,6,12,13,19,20-hexaethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 4918984 |
| Molecular Formula | C33H42O6 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 5,6,12,13,19,20-hexaethoxytetracyclo[15.4.0.03,8.010,15]henicosa-1(21),3,5,7,10,12,14,17,19-nonaene |
| SMILES | CCOc1cc2c(cc1OCC)Cc1cc(OCC)c(OCC)cc1Cc1cc(OCC)c(OCC)cc1C2 |
| InChI | InChI=1S/C33H42O6/c1-7-34-28-16-22-13-24-18-30(36-9-3)32(38-11-5)20-26(24)15-27-21-33(39-12-6)31(37-10-4)19-25(27)14-23(22)17-29(28)35-8-2/h16-21H,7-15H2,1-6H3 |
| InChIKey | IWJWAWDBOXNNCB-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |