C19H13F5N2O2 — CID 4919473
1-naphthalen-1-yl-3-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]urea (PubChem CID 4919473) has the molecular formula C19H13F5N2O2 and a molecular weight of 396.32 g/mol. Its IUPAC name is 1-naphthalen-1-yl-3-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]urea.
| Compound Name | 1-naphthalen-1-yl-3-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]urea |
|---|---|
| PubChem CID | 4919473 |
| Molecular Formula | C19H13F5N2O2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-naphthalen-1-yl-3-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]urea |
| SMILES | O=C(NCCOc1c(F)c(F)c(F)c(F)c1F)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H13F5N2O2/c20-13-14(21)16(23)18(17(24)15(13)22)28-9-8-25-19(27)26-12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9H2,(H2,25,26,27) |
| InChIKey | ANKOVPUACIWSDJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|